C21H23ClFN3O2S — CID 130340806
(Z)-N-chloro-4-[3-(3-ethylsulfonylphenyl)-2,5-dimethylpyrrolo[3,2-b]pyridin-1-yl]-3-fluorobut-2-en-1-amine (PubChem CID 130340806) has the molecular formula C21H23ClFN3O2S and a molecular weight of 435.95 g/mol. Its IUPAC name is (Z)-N-chloro-4-[3-(3-ethylsulfonylphenyl)-2,5-dimethylpyrrolo[3,2-b]pyridin-1-yl]-3-fluorobut-2-en-1-amine.
| Compound Name | (Z)-N-chloro-4-[3-(3-ethylsulfonylphenyl)-2,5-dimethylpyrrolo[3,2-b]pyridin-1-yl]-3-fluorobut-2-en-1-amine |
|---|---|
| PubChem CID | 130340806 |
| Molecular Formula | C21H23ClFN3O2S |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (Z)-N-chloro-4-[3-(3-ethylsulfonylphenyl)-2,5-dimethylpyrrolo[3,2-b]pyridin-1-yl]-3-fluorobut-2-en-1-amine |
| SMILES | CCS(=O)(=O)c1cccc(-c2c(C)n(C/C(F)=C/CNCl)c3ccc(C)nc23)c1 |
| InChI | InChI=1S/C21H23ClFN3O2S/c1-4-29(27,28)18-7-5-6-16(12-18)20-15(3)26(13-17(23)10-11-24-22)19-9-8-14(2)25-21(19)20/h5-10,12,24H,4,11,13H2,1-3H3/b17-10- |
| InChIKey | MEKRWZQGLSRYNC-YVLHZVERSA-N |
| XLogP | 4.71 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|