C16H16O4S — CID 91880310
2-(2-hydroxy-3,4-dimethoxyphenyl)sulfanyl-1-phenylethanone (PubChem CID 91880310) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-(2-hydroxy-3,4-dimethoxyphenyl)sulfanyl-1-phenylethanone.
| Compound Name | 2-(2-hydroxy-3,4-dimethoxyphenyl)sulfanyl-1-phenylethanone |
|---|---|
| PubChem CID | 91880310 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-(2-hydroxy-3,4-dimethoxyphenyl)sulfanyl-1-phenylethanone |
| SMILES | COc1ccc(SCC(=O)c2ccccc2)c(O)c1OC |
| InChI | InChI=1S/C16H16O4S/c1-19-13-8-9-14(15(18)16(13)20-2)21-10-12(17)11-6-4-3-5-7-11/h3-9,18H,10H2,1-2H3 |
| InChIKey | YNDVIRHZSIFJBD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |