C11H12O5 — CID 91299135
3-(2-hydroxy-3,4-dimethoxyphenyl)-3-oxopropanal (PubChem CID 91299135) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is 3-(2-hydroxy-3,4-dimethoxyphenyl)-3-oxopropanal.
| Compound Name | 3-(2-hydroxy-3,4-dimethoxyphenyl)-3-oxopropanal |
|---|---|
| PubChem CID | 91299135 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-(2-hydroxy-3,4-dimethoxyphenyl)-3-oxopropanal |
| SMILES | COc1ccc(C(=O)CC=O)c(O)c1OC |
| InChI | InChI=1S/C11H12O5/c1-15-9-4-3-7(8(13)5-6-12)10(14)11(9)16-2/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | ZOWDEIQSYXTSRR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|