C15H13FO4 — CID 15750347
(2-fluorophenyl)-(2-hydroxy-3,4-dimethoxyphenyl)methanone (PubChem CID 15750347) has the molecular formula C15H13FO4 and a molecular weight of 276.26 g/mol. Its IUPAC name is (2-fluorophenyl)-(2-hydroxy-3,4-dimethoxyphenyl)methanone.
| Compound Name | (2-fluorophenyl)-(2-hydroxy-3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 15750347 |
| Molecular Formula | C15H13FO4 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (2-fluorophenyl)-(2-hydroxy-3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccccc2F)c(O)c1OC |
| InChI | InChI=1S/C15H13FO4/c1-19-12-8-7-10(14(18)15(12)20-2)13(17)9-5-3-4-6-11(9)16/h3-8,18H,1-2H3 |
| InChIKey | MENPTHQIWNTWCZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |