C16H14N2O3 — CID 69156462
2-(2-amino-3,4-dimethoxybenzoyl)benzonitrile (PubChem CID 69156462) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-(2-amino-3,4-dimethoxybenzoyl)benzonitrile.
| Compound Name | 2-(2-amino-3,4-dimethoxybenzoyl)benzonitrile |
|---|---|
| PubChem CID | 69156462 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(2-amino-3,4-dimethoxybenzoyl)benzonitrile |
| SMILES | COc1ccc(C(=O)c2ccccc2C#N)c(N)c1OC |
| InChI | InChI=1S/C16H14N2O3/c1-20-13-8-7-12(14(18)16(13)21-2)15(19)11-6-4-3-5-10(11)9-17/h3-8H,18H2,1-2H3 |
| InChIKey | WJBVVIJXEIMUIA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|