C24H21NO5 — CID 30290785
[4-(2-cyanophenyl)phenyl]methyl 2,3,4-trimethoxybenzoate (PubChem CID 30290785) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is [4-(2-cyanophenyl)phenyl]methyl 2,3,4-trimethoxybenzoate.
| Compound Name | [4-(2-cyanophenyl)phenyl]methyl 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 30290785 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [4-(2-cyanophenyl)phenyl]methyl 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2ccc(-c3ccccc3C#N)cc2)c(OC)c1OC |
| InChI | InChI=1S/C24H21NO5/c1-27-21-13-12-20(22(28-2)23(21)29-3)24(26)30-15-16-8-10-17(11-9-16)19-7-5-4-6-18(19)14-25/h4-13H,15H2,1-3H3 |
| InChIKey | UTRGTYCQSULYHD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |