C10H11N3O2 — CID 141290589
ethyl 1-aminopyrrolo[3,2-b]pyridine-2-carboxylate (PubChem CID 141290589) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is ethyl 1-aminopyrrolo[3,2-b]pyridine-2-carboxylate.
| Compound Name | ethyl 1-aminopyrrolo[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 141290589 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | ethyl 1-aminopyrrolo[3,2-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2ncccc2n1N |
| InChI | InChI=1S/C10H11N3O2/c1-2-15-10(14)9-6-7-8(13(9)11)4-3-5-12-7/h3-6H,2,11H2,1H3 |
| InChIKey | GSMFUWCVBIIAKF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |