C10H9NO2Se — CID 611014
ethyl selenopheno[2,3-b]pyridine-2-carboxylate (PubChem CID 611014) has the molecular formula C10H9NO2Se and a molecular weight of 254.15 g/mol. Its IUPAC name is ethyl selenopheno[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl selenopheno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 611014 |
| Molecular Formula | C10H9NO2Se |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | ethyl selenopheno[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cccnc2[se]1 |
| InChI | InChI=1S/C10H9NO2Se/c1-2-13-10(12)8-6-7-4-3-5-11-9(7)14-8/h3-6H,2H2,1H3 |
| InChIKey | AVTFDQBYLSWKIS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|