C20H22N2O6 — CID 10548183
triethyl 4-methylpyrrolo[1,2-a]benzimidazole-1,2,3-tricarboxylate (PubChem CID 10548183) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is triethyl 4-methylpyrrolo[1,2-a]benzimidazole-1,2,3-tricarboxylate.
| Compound Name | triethyl 4-methylpyrrolo[1,2-a]benzimidazole-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 10548183 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | triethyl 4-methylpyrrolo[1,2-a]benzimidazole-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c2n(C)c3ccccc3n2c1C(=O)OCC |
| InChI | InChI=1S/C20H22N2O6/c1-5-26-18(23)14-15(19(24)27-6-2)17-21(4)12-10-8-9-11-13(12)22(17)16(14)20(25)28-7-3/h8-11H,5-7H2,1-4H3 |
| InChIKey | CATAHTDMTCLJHS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|