C17H19NO5S — CID 14708951
diethyl 2-(2-oxopropylsulfanyl)indolizine-1,3-dicarboxylate (PubChem CID 14708951) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is diethyl 2-(2-oxopropylsulfanyl)indolizine-1,3-dicarboxylate.
| Compound Name | diethyl 2-(2-oxopropylsulfanyl)indolizine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 14708951 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | diethyl 2-(2-oxopropylsulfanyl)indolizine-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(SCC(C)=O)c(C(=O)OCC)n2ccccc12 |
| InChI | InChI=1S/C17H19NO5S/c1-4-22-16(20)13-12-8-6-7-9-18(12)14(17(21)23-5-2)15(13)24-10-11(3)19/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | UUITYTAUBJUSCE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |