C17H16N2O3S — CID 19843302
ethyl 3-cyano-2-(2-methylprop-2-enylsulfanyl)-4-oxoquinolizine-1-carboxylate (PubChem CID 19843302) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is ethyl 3-cyano-2-(2-methylprop-2-enylsulfanyl)-4-oxoquinolizine-1-carboxylate.
| Compound Name | ethyl 3-cyano-2-(2-methylprop-2-enylsulfanyl)-4-oxoquinolizine-1-carboxylate |
|---|---|
| PubChem CID | 19843302 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | ethyl 3-cyano-2-(2-methylprop-2-enylsulfanyl)-4-oxoquinolizine-1-carboxylate |
| SMILES | C=C(C)CSc1c(C#N)c(=O)n2ccccc2c1C(=O)OCC |
| InChI | InChI=1S/C17H16N2O3S/c1-4-22-17(21)14-13-7-5-6-8-19(13)16(20)12(9-18)15(14)23-10-11(2)3/h5-8H,2,4,10H2,1,3H3 |
| InChIKey | BROYPBRDEASJQS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|