C14H9Cl3N2O3S — CID 19843299
2,2,2-trichloroethyl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate (PubChem CID 19843299) has the molecular formula C14H9Cl3N2O3S and a molecular weight of 391.66 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate |
|---|---|
| PubChem CID | 19843299 |
| Molecular Formula | C14H9Cl3N2O3S |
| Molecular Weight | 391.66 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 2,2,2-trichloroethyl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate |
| SMILES | CSc1c(C#N)c(=O)n2ccccc2c1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H9Cl3N2O3S/c1-23-11-8(6-18)12(20)19-5-3-2-4-9(19)10(11)13(21)22-7-14(15,16)17/h2-5H,7H2,1H3 |
| InChIKey | SMKBMQNLJODCHU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|