C18H16N2O3S — CID 15055648
cyclohex-2-en-1-yl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate (PubChem CID 15055648) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is cyclohex-2-en-1-yl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate.
| Compound Name | cyclohex-2-en-1-yl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate |
|---|---|
| PubChem CID | 15055648 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | cyclohex-2-en-1-yl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate |
| SMILES | CSc1c(C#N)c(=O)n2ccccc2c1C(=O)OC1C=CCCC1 |
| InChI | InChI=1S/C18H16N2O3S/c1-24-16-13(11-19)17(21)20-10-6-5-9-14(20)15(16)18(22)23-12-7-3-2-4-8-12/h3,5-7,9-10,12H,2,4,8H2,1H3 |
| InChIKey | BCJXUCPUFWMEMT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|