C28H25NO3 — CID 132941529
cyclohexyl 3-benzoyl-2-phenylindolizine-1-carboxylate (PubChem CID 132941529) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is cyclohexyl 3-benzoyl-2-phenylindolizine-1-carboxylate.
| Compound Name | cyclohexyl 3-benzoyl-2-phenylindolizine-1-carboxylate |
|---|---|
| PubChem CID | 132941529 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | cyclohexyl 3-benzoyl-2-phenylindolizine-1-carboxylate |
| SMILES | O=C(OC1CCCCC1)c1c(-c2ccccc2)c(C(=O)c2ccccc2)n2ccccc12 |
| InChI | InChI=1S/C28H25NO3/c30-27(21-14-6-2-7-15-21)26-24(20-12-4-1-5-13-20)25(23-18-10-11-19-29(23)26)28(31)32-22-16-8-3-9-17-22/h1-2,4-7,10-15,18-19,22H,3,8-9,16-17H2 |
| InChIKey | XIVLDBFHQRFNOP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |