C23H13NO3 — CID 12067040
6-benzoylnaphtho[2,3-a]indolizine-7,12-dione (PubChem CID 12067040) has the molecular formula C23H13NO3 and a molecular weight of 351.36 g/mol. Its IUPAC name is 6-benzoylnaphtho[2,3-a]indolizine-7,12-dione.
| Compound Name | 6-benzoylnaphtho[2,3-a]indolizine-7,12-dione |
|---|---|
| PubChem CID | 12067040 |
| Molecular Formula | C23H13NO3 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 6-benzoylnaphtho[2,3-a]indolizine-7,12-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(C(=O)c1ccccc1)n1ccccc21 |
| InChI | InChI=1S/C23H13NO3/c25-21(14-8-2-1-3-9-14)20-19-18(17-12-6-7-13-24(17)20)22(26)15-10-4-5-11-16(15)23(19)27/h1-13H |
| InChIKey | OFAXKEZRZKVMFQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|