C16H16N2O3S — CID 15055682
butan-2-yl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate (PubChem CID 15055682) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is butan-2-yl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate.
| Compound Name | butan-2-yl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate |
|---|---|
| PubChem CID | 15055682 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | butan-2-yl 3-cyano-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate |
| SMILES | CCC(C)OC(=O)c1c(SC)c(C#N)c(=O)n2ccccc12 |
| InChI | InChI=1S/C16H16N2O3S/c1-4-10(2)21-16(20)13-12-7-5-6-8-18(12)15(19)11(9-17)14(13)22-3/h5-8,10H,4H2,1-3H3 |
| InChIKey | YUDIFYNTRPQUTK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |