C19H17N5O3 — CID 56623522
ethyl 3-cyano-2-[methyl-(6-methylpyrazin-2-yl)amino]-4-oxoquinolizine-1-carboxylate (PubChem CID 56623522) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is ethyl 3-cyano-2-[methyl-(6-methylpyrazin-2-yl)amino]-4-oxoquinolizine-1-carboxylate.
| Compound Name | ethyl 3-cyano-2-[methyl-(6-methylpyrazin-2-yl)amino]-4-oxoquinolizine-1-carboxylate |
|---|---|
| PubChem CID | 56623522 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | ethyl 3-cyano-2-[methyl-(6-methylpyrazin-2-yl)amino]-4-oxoquinolizine-1-carboxylate |
| SMILES | CCOC(=O)c1c(N(C)c2cncc(C)n2)c(C#N)c(=O)n2ccccc12 |
| InChI | InChI=1S/C19H17N5O3/c1-4-27-19(26)16-14-7-5-6-8-24(14)18(25)13(9-20)17(16)23(3)15-11-21-10-12(2)22-15/h5-8,10-11H,4H2,1-3H3 |
| InChIKey | NUNJIIFQPXWLAT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 100.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |