C22H20N2O3S — CID 15055703
3-phenylpropyl 3-cyano-8-methyl-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate (PubChem CID 15055703) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-phenylpropyl 3-cyano-8-methyl-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate.
| Compound Name | 3-phenylpropyl 3-cyano-8-methyl-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate |
|---|---|
| PubChem CID | 15055703 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-phenylpropyl 3-cyano-8-methyl-2-methylsulfanyl-4-oxoquinolizine-1-carboxylate |
| SMILES | CSc1c(C#N)c(=O)n2ccc(C)cc2c1C(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-15-10-11-24-18(13-15)19(20(28-2)17(14-23)21(24)25)22(26)27-12-6-9-16-7-4-3-5-8-16/h3-5,7-8,10-11,13H,6,9,12H2,1-2H3 |
| InChIKey | MACZZUXEENQEGM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|