C23H23NO5S — CID 14708955
diethyl 7-methyl-2-phenacylsulfanylindolizine-1,3-dicarboxylate (PubChem CID 14708955) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is diethyl 7-methyl-2-phenacylsulfanylindolizine-1,3-dicarboxylate.
| Compound Name | diethyl 7-methyl-2-phenacylsulfanylindolizine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 14708955 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | diethyl 7-methyl-2-phenacylsulfanylindolizine-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(SCC(=O)c2ccccc2)c(C(=O)OCC)n2ccc(C)cc12 |
| InChI | InChI=1S/C23H23NO5S/c1-4-28-22(26)19-17-13-15(3)11-12-24(17)20(23(27)29-5-2)21(19)30-14-18(25)16-9-7-6-8-10-16/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | LWVJLJOVVGYPHB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |