C32H36N2O8S2 — CID 11006762
diethyl 2-[2-[1,3-bis(ethoxycarbonyl)-7-methylindolizin-2-yl]sulfanylethylsulfanyl]-7-methylindolizine-1,3-dicarboxylate (PubChem CID 11006762) has the molecular formula C32H36N2O8S2 and a molecular weight of 640.78 g/mol. Its IUPAC name is diethyl 2-[2-[1,3-bis(ethoxycarbonyl)-7-methylindolizin-2-yl]sulfanylethylsulfanyl]-7-methylindolizine-1,3-dicarboxylate.
| Compound Name | diethyl 2-[2-[1,3-bis(ethoxycarbonyl)-7-methylindolizin-2-yl]sulfanylethylsulfanyl]-7-methylindolizine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11006762 |
| Molecular Formula | C32H36N2O8S2 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | diethyl 2-[2-[1,3-bis(ethoxycarbonyl)-7-methylindolizin-2-yl]sulfanylethylsulfanyl]-7-methylindolizine-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(SCCSc2c(C(=O)OCC)c3cc(C)ccn3c2C(=O)OCC)c(C(=O)OCC)n2ccc(C)cc12 |
| InChI | InChI=1S/C32H36N2O8S2/c1-7-39-29(35)23-21-17-19(5)11-13-33(21)25(31(37)41-9-3)27(23)43-15-16-44-28-24(30(36)40-8-2)22-18-20(6)12-14-34(22)26(28)32(38)42-10-4/h11-14,17-18H,7-10,15-16H2,1-6H3 |
| InChIKey | YVFRKNLYAFXQDT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|