C21H15ClKNO3S2 — CID 23672190
potassium 3-(4-chlorobenzoyl)-4-ethoxycarbonyl-6-methylthieno[3,4-b]indolizine-1-thiolate (PubChem CID 23672190) has the molecular formula C21H15ClKNO3S2 and a molecular weight of 468.04 g/mol. Its IUPAC name is potassium 3-(4-chlorobenzoyl)-4-ethoxycarbonyl-6-methylthieno[3,4-b]indolizine-1-thiolate.
| Compound Name | potassium 3-(4-chlorobenzoyl)-4-ethoxycarbonyl-6-methylthieno[3,4-b]indolizine-1-thiolate |
|---|---|
| PubChem CID | 23672190 |
| Molecular Formula | C21H15ClKNO3S2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | potassium 3-(4-chlorobenzoyl)-4-ethoxycarbonyl-6-methylthieno[3,4-b]indolizine-1-thiolate |
| SMILES | CCOC(=O)c1c2c(C(=O)c3ccc(Cl)cc3)sc([S-])c2n2ccc(C)cc12.[K+] |
| InChI | InChI=1S/C21H16ClNO3S2.K/c1-3-26-20(25)15-14-10-11(2)8-9-23(14)17-16(15)19(28-21(17)27)18(24)12-4-6-13(22)7-5-12;/h4-10,27H,3H2,1-2H3;/q;+1/p-1 |
| InChIKey | SWFBIIRDKTUBFM-UHFFFAOYSA-M |
| XLogP | 2.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|