C25H20BrNO3S2 — CID 11591788
ethyl 3-(4-bromobenzoyl)-1-but-2-ynylsulfanyl-6-methylthieno[3,4-b]indolizine-4-carboxylate (PubChem CID 11591788) has the molecular formula C25H20BrNO3S2 and a molecular weight of 526.48 g/mol. Its IUPAC name is ethyl 3-(4-bromobenzoyl)-1-but-2-ynylsulfanyl-6-methylthieno[3,4-b]indolizine-4-carboxylate.
| Compound Name | ethyl 3-(4-bromobenzoyl)-1-but-2-ynylsulfanyl-6-methylthieno[3,4-b]indolizine-4-carboxylate |
|---|---|
| PubChem CID | 11591788 |
| Molecular Formula | C25H20BrNO3S2 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | ethyl 3-(4-bromobenzoyl)-1-but-2-ynylsulfanyl-6-methylthieno[3,4-b]indolizine-4-carboxylate |
| SMILES | CC#CCSc1sc(C(=O)c2ccc(Br)cc2)c2c(C(=O)OCC)c3cc(C)ccn3c12 |
| InChI | InChI=1S/C25H20BrNO3S2/c1-4-6-13-31-25-21-20(23(32-25)22(28)16-7-9-17(26)10-8-16)19(24(29)30-5-2)18-14-15(3)11-12-27(18)21/h7-12,14H,5,13H2,1-3H3 |
| InChIKey | SRQRPZKJLGQHKJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|