C33H25NO3S2 — CID 11146028
ethyl 1-benzhydrylsulfanyl-3-benzoylthieno[3,4-b]indolizine-4-carboxylate (PubChem CID 11146028) has the molecular formula C33H25NO3S2 and a molecular weight of 547.70 g/mol. Its IUPAC name is ethyl 1-benzhydrylsulfanyl-3-benzoylthieno[3,4-b]indolizine-4-carboxylate.
| Compound Name | ethyl 1-benzhydrylsulfanyl-3-benzoylthieno[3,4-b]indolizine-4-carboxylate |
|---|---|
| PubChem CID | 11146028 |
| Molecular Formula | C33H25NO3S2 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | ethyl 1-benzhydrylsulfanyl-3-benzoylthieno[3,4-b]indolizine-4-carboxylate |
| SMILES | CCOC(=O)c1c2c(C(=O)c3ccccc3)sc(SC(c3ccccc3)c3ccccc3)c2n2ccccc12 |
| InChI | InChI=1S/C33H25NO3S2/c1-2-37-32(36)26-25-20-12-13-21-34(25)28-27(26)31(29(35)22-14-6-3-7-15-22)39-33(28)38-30(23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-21,30H,2H2,1H3 |
| InChIKey | SMANJKKPXVXHBB-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |