C23H27NO2S — CID 146270653
ethyl 3-[(S)-3-methylbutylsulfanyl(phenyl)methyl]indolizine-1-carboxylate (PubChem CID 146270653) has the molecular formula C23H27NO2S and a molecular weight of 381.54 g/mol. Its IUPAC name is ethyl 3-[(S)-3-methylbutylsulfanyl(phenyl)methyl]indolizine-1-carboxylate.
| Compound Name | ethyl 3-[(S)-3-methylbutylsulfanyl(phenyl)methyl]indolizine-1-carboxylate |
|---|---|
| PubChem CID | 146270653 |
| Molecular Formula | C23H27NO2S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | ethyl 3-[(S)-3-methylbutylsulfanyl(phenyl)methyl]indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc([C@@H](SCCC(C)C)c2ccccc2)n2ccccc12 |
| InChI | InChI=1S/C23H27NO2S/c1-4-26-23(25)19-16-21(24-14-9-8-12-20(19)24)22(27-15-13-17(2)3)18-10-6-5-7-11-18/h5-12,14,16-17,22H,4,13,15H2,1-3H3/t22-/m0/s1 |
| InChIKey | YCECZURVGPFZSV-QFIPXVFZSA-N |
| XLogP | 5.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |