C26H26N2O2 — CID 146270137
ethyl 3-[(S)-(3,5-dimethylanilino)-phenylmethyl]indolizine-1-carboxylate (PubChem CID 146270137) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is ethyl 3-[(S)-(3,5-dimethylanilino)-phenylmethyl]indolizine-1-carboxylate.
| Compound Name | ethyl 3-[(S)-(3,5-dimethylanilino)-phenylmethyl]indolizine-1-carboxylate |
|---|---|
| PubChem CID | 146270137 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | ethyl 3-[(S)-(3,5-dimethylanilino)-phenylmethyl]indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc([C@@H](Nc2cc(C)cc(C)c2)c2ccccc2)n2ccccc12 |
| InChI | InChI=1S/C26H26N2O2/c1-4-30-26(29)22-17-24(28-13-9-8-12-23(22)28)25(20-10-6-5-7-11-20)27-21-15-18(2)14-19(3)16-21/h5-17,25,27H,4H2,1-3H3/t25-/m0/s1 |
| InChIKey | RCQZTTPPGPRUBC-VWLOTQADSA-N |
| XLogP | 5.93 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |