C20H23NO3 — CID 56645067
ethyl 3-(3-methylbutoxy)pyrido[1,2-a]indole-10-carboxylate (PubChem CID 56645067) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is ethyl 3-(3-methylbutoxy)pyrido[1,2-a]indole-10-carboxylate.
| Compound Name | ethyl 3-(3-methylbutoxy)pyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 56645067 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | ethyl 3-(3-methylbutoxy)pyrido[1,2-a]indole-10-carboxylate |
| SMILES | CCOC(=O)c1c2ccc(OCCC(C)C)cc2n2ccccc12 |
| InChI | InChI=1S/C20H23NO3/c1-4-23-20(22)19-16-9-8-15(24-12-10-14(2)3)13-18(16)21-11-6-5-7-17(19)21/h5-9,11,13-14H,4,10,12H2,1-3H3 |
| InChIKey | VUYHHLIMMAXZHW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |