C21H18N2O3 — CID 66667081
hex-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate (PubChem CID 66667081) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is hex-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate.
| Compound Name | hex-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 66667081 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | hex-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
| SMILES | CCC#CC(C)OC(=O)c1c2ccc(OCC#N)cc2n2ccccc12 |
| InChI | InChI=1S/C21H18N2O3/c1-3-4-7-15(2)26-21(24)20-17-10-9-16(25-13-11-22)14-19(17)23-12-6-5-8-18(20)23/h5-6,8-10,12,14-15H,3,13H2,1-2H3 |
| InChIKey | NDEZDFNVXHQAOI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|