C19H16N2O4 — CID 66665871
2-hydroxybut-3-enyl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate (PubChem CID 66665871) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-hydroxybut-3-enyl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate.
| Compound Name | 2-hydroxybut-3-enyl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 66665871 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-hydroxybut-3-enyl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
| SMILES | C=CC(O)COC(=O)c1c2ccc(OCC#N)cc2n2ccccc12 |
| InChI | InChI=1S/C19H16N2O4/c1-2-13(22)12-25-19(23)18-15-7-6-14(24-10-8-20)11-17(15)21-9-4-3-5-16(18)21/h2-7,9,11,13,22H,1,10,12H2 |
| InChIKey | GXQWZMOWHPQVIB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|