About (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate
(3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate (PubChem CID 66667884) has the molecular formula C22H15ClN2O3
and a molecular weight of 390.83 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate.
Molecular Properties
| Compound Name | (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
| PubChem CID | 66667884 |
| Molecular Formula | C22H15ClN2O3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
| SMILES | N#CCOc1ccc2c(C(=O)OCc3cccc(Cl)c3)c3ccccc3n2c1 |
| InChI | InChI=1S/C22H15ClN2O3/c23-16-5-3-4-15(12-16)14-28-22(26)21-18-6-1-2-7-19(18)25-13-17(27-11-10-24)8-9-20(21)25/h1-9,12-13H,11,14H2 |
| InChIKey | CHEGPLWKAJCLEG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
The IUPAC name of (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate (CID 66667884) is (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate.
What is the SMILES notation for (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
The canonical SMILES for (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate is N#CCOc1ccc2c(C(=O)OCc3cccc(Cl)c3)c3ccccc3n2c1.
What is the InChIKey of (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
The InChIKey is CHEGPLWKAJCLEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClN2O3/c23-16-5-3-4-15(12-16)14-28-22(26)21-18-6-1-2-7-19(18)25-13-17(27-11-10-24)8-9-20(21)25/h1-9,12-13H,11,14H2.
What are the key properties of (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
(3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate has a molecular weight of 390.83 g/mol, XLogP of 5.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methyl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate is sourced from PubChem (CID 66667884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).