C20H20N2O3 — CID 66667599
pentyl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate (PubChem CID 66667599) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is pentyl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate.
| Compound Name | pentyl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 66667599 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | pentyl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
| SMILES | CCCCCOC(=O)c1c2ccc(OCC#N)cc2n2ccccc12 |
| InChI | InChI=1S/C20H20N2O3/c1-2-3-6-12-25-20(23)19-16-9-8-15(24-13-10-21)14-18(16)22-11-5-4-7-17(19)22/h4-5,7-9,11,14H,2-3,6,12-13H2,1H3 |
| InChIKey | FJRZQULWUVPIKV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|