About hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate
hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate (PubChem CID 66667700) has the molecular formula C22H20N2O3
and a molecular weight of 360.41 g/mol. Its IUPAC name is hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate.
Molecular Properties
| Compound Name | hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
| PubChem CID | 66667700 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
| SMILES | CCCC#CC(C)OC(=O)c1c2ccc(OCC#N)cc2n2ccccc12 |
| InChI | InChI=1S/C22H20N2O3/c1-3-4-5-8-16(2)27-22(25)21-18-11-10-17(26-14-12-23)15-20(18)24-13-7-6-9-19(21)24/h6-7,9-11,13,15-16H,3-4,14H2,1-2H3 |
| InChIKey | ABQQJKKXHSFRKH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
The IUPAC name of hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate (CID 66667700) is hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate.
What is the SMILES notation for hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
The canonical SMILES for hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate is CCCC#CC(C)OC(=O)c1c2ccc(OCC#N)cc2n2ccccc12.
What is the InChIKey of hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
The InChIKey is ABQQJKKXHSFRKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O3/c1-3-4-5-8-16(2)27-22(25)21-18-11-10-17(26-14-12-23)15-20(18)24-13-7-6-9-19(21)24/h6-7,9-11,13,15-16H,3-4,14H2,1-2H3.
What are the key properties of hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate has a molecular weight of 360.41 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hept-3-yn-2-yl 3-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate is sourced from PubChem (CID 66667700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).