C14H12N2O2 — CID 56645534
3-methoxypyrido[1,2-a]indole-10-carboxamide (PubChem CID 56645534) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-methoxypyrido[1,2-a]indole-10-carboxamide.
| Compound Name | 3-methoxypyrido[1,2-a]indole-10-carboxamide |
|---|---|
| PubChem CID | 56645534 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-methoxypyrido[1,2-a]indole-10-carboxamide |
| SMILES | COc1ccc2c(C(N)=O)c3ccccn3c2c1 |
| InChI | InChI=1S/C14H12N2O2/c1-18-9-5-6-10-12(8-9)16-7-3-2-4-11(16)13(10)14(15)17/h2-8H,1H3,(H2,15,17) |
| InChIKey | PQMMJZUGVLDKLE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |