C17H16N2O5S — CID 87097342
(10-carbamoyl-1-methoxypyrido[1,2-a]indol-3-yl) cyclopropanesulfonate (PubChem CID 87097342) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is (10-carbamoyl-1-methoxypyrido[1,2-a]indol-3-yl) cyclopropanesulfonate.
| Compound Name | (10-carbamoyl-1-methoxypyrido[1,2-a]indol-3-yl) cyclopropanesulfonate |
|---|---|
| PubChem CID | 87097342 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (10-carbamoyl-1-methoxypyrido[1,2-a]indol-3-yl) cyclopropanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C2CC2)cc2c1c(C(N)=O)c1ccccn12 |
| InChI | InChI=1S/C17H16N2O5S/c1-23-14-9-10(24-25(21,22)11-5-6-11)8-13-15(14)16(17(18)20)12-4-2-3-7-19(12)13/h2-4,7-9,11H,5-6H2,1H3,(H2,18,20) |
| InChIKey | BQHHSHCGFVWEAM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|