C19H19NO6 — CID 57342285
dimethyl 2-(1,3-dimethoxypyrido[1,2-a]indol-10-yl)propanedioate (PubChem CID 57342285) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is dimethyl 2-(1,3-dimethoxypyrido[1,2-a]indol-10-yl)propanedioate.
| Compound Name | dimethyl 2-(1,3-dimethoxypyrido[1,2-a]indol-10-yl)propanedioate |
|---|---|
| PubChem CID | 57342285 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | dimethyl 2-(1,3-dimethoxypyrido[1,2-a]indol-10-yl)propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1c2c(OC)cc(OC)cc2n2ccccc12 |
| InChI | InChI=1S/C19H19NO6/c1-23-11-9-13-15(14(10-11)24-2)16(12-7-5-6-8-20(12)13)17(18(21)25-3)19(22)26-4/h5-10,17H,1-4H3 |
| InChIKey | AEGWWVBPPZKGKT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|