About 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide
3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide (PubChem CID 66667151) has the molecular formula C15H13N3O2
and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide.
Molecular Properties
| Compound Name | 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide |
| PubChem CID | 66667151 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide |
| SMILES | CNC(=O)c1ccc2c(C(N)=O)c3ccccn3c2c1 |
| InChI | InChI=1S/C15H13N3O2/c1-17-15(20)9-5-6-10-12(8-9)18-7-3-2-4-11(18)13(10)14(16)19/h2-8H,1H3,(H2,16,19)(H,17,20) |
| InChIKey | JMUYHNFCGSGFDJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide?
The IUPAC name of 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide (CID 66667151) is 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide.
What is the SMILES notation for 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide?
The canonical SMILES for 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide is CNC(=O)c1ccc2c(C(N)=O)c3ccccn3c2c1.
What is the InChIKey of 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide?
The InChIKey is JMUYHNFCGSGFDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O2/c1-17-15(20)9-5-6-10-12(8-9)18-7-3-2-4-11(18)13(10)14(16)19/h2-8H,1H3,(H2,16,19)(H,17,20).
What are the key properties of 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide?
3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide has a molecular weight of 267.29 g/mol, XLogP of 1.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-methylpyrido[1,2-a]indole-3,10-dicarboxamide is sourced from PubChem (CID 66667151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).