C33H38N2O8S2 — CID 11082848
diethyl 2-[3-[1,3-bis(ethoxycarbonyl)-7-methylindolizin-2-yl]sulfanylpropylsulfanyl]-7-methylindolizine-1,3-dicarboxylate (PubChem CID 11082848) has the molecular formula C33H38N2O8S2 and a molecular weight of 654.81 g/mol. Its IUPAC name is diethyl 2-[3-[1,3-bis(ethoxycarbonyl)-7-methylindolizin-2-yl]sulfanylpropylsulfanyl]-7-methylindolizine-1,3-dicarboxylate.
| Compound Name | diethyl 2-[3-[1,3-bis(ethoxycarbonyl)-7-methylindolizin-2-yl]sulfanylpropylsulfanyl]-7-methylindolizine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11082848 |
| Molecular Formula | C33H38N2O8S2 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.21 |
| IUPAC Name | diethyl 2-[3-[1,3-bis(ethoxycarbonyl)-7-methylindolizin-2-yl]sulfanylpropylsulfanyl]-7-methylindolizine-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(SCCCSc2c(C(=O)OCC)c3cc(C)ccn3c2C(=O)OCC)c(C(=O)OCC)n2ccc(C)cc12 |
| InChI | InChI=1S/C33H38N2O8S2/c1-7-40-30(36)24-22-18-20(5)12-14-34(22)26(32(38)42-9-3)28(24)44-16-11-17-45-29-25(31(37)41-8-2)23-19-21(6)13-15-35(23)27(29)33(39)43-10-4/h12-15,18-19H,7-11,16-17H2,1-6H3 |
| InChIKey | ACTKTOXEULGNRU-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|