C23H25NO4S — CID 101356316
diethyl 2-benzylsulfanyl-6,8-dimethylindolizine-1,3-dicarboxylate (PubChem CID 101356316) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is diethyl 2-benzylsulfanyl-6,8-dimethylindolizine-1,3-dicarboxylate.
| Compound Name | diethyl 2-benzylsulfanyl-6,8-dimethylindolizine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101356316 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | diethyl 2-benzylsulfanyl-6,8-dimethylindolizine-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(SCc2ccccc2)c(C(=O)OCC)n2cc(C)cc(C)c12 |
| InChI | InChI=1S/C23H25NO4S/c1-5-27-22(25)18-19-16(4)12-15(3)13-24(19)20(23(26)28-6-2)21(18)29-14-17-10-8-7-9-11-17/h7-13H,5-6,14H2,1-4H3 |
| InChIKey | VQTBBFLJWRUHGY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |