C28H32O2S — CID 177152845
(4-benzylsulfanyl-2,3,5,6-tetramethylphenyl) 2,3,4,6-tetramethylbenzoate (PubChem CID 177152845) has the molecular formula C28H32O2S and a molecular weight of 432.63 g/mol. Its IUPAC name is (4-benzylsulfanyl-2,3,5,6-tetramethylphenyl) 2,3,4,6-tetramethylbenzoate.
| Compound Name | (4-benzylsulfanyl-2,3,5,6-tetramethylphenyl) 2,3,4,6-tetramethylbenzoate |
|---|---|
| PubChem CID | 177152845 |
| Molecular Formula | C28H32O2S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (4-benzylsulfanyl-2,3,5,6-tetramethylphenyl) 2,3,4,6-tetramethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)Oc2c(C)c(C)c(SCc3ccccc3)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C28H32O2S/c1-16-14-17(2)25(19(4)18(16)3)28(29)30-26-20(5)22(7)27(23(8)21(26)6)31-15-24-12-10-9-11-13-24/h9-14H,15H2,1-8H3 |
| InChIKey | APCYDLHFCHULGG-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|