C28H33N3O3 — CID 177152939
[4-[(Z)-C-aminocarbonohydrazonoyl]-2,3,5,6-tetramethylphenyl] 2,3,6-trimethyl-4-phenylmethoxybenzoate (PubChem CID 177152939) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is [4-[(Z)-C-aminocarbonohydrazonoyl]-2,3,5,6-tetramethylphenyl] 2,3,6-trimethyl-4-phenylmethoxybenzoate.
| Compound Name | [4-[(Z)-C-aminocarbonohydrazonoyl]-2,3,5,6-tetramethylphenyl] 2,3,6-trimethyl-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 177152939 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | [4-[(Z)-C-aminocarbonohydrazonoyl]-2,3,5,6-tetramethylphenyl] 2,3,6-trimethyl-4-phenylmethoxybenzoate |
| SMILES | Cc1cc(OCc2ccccc2)c(C)c(C)c1C(=O)Oc1c(C)c(C)c(/C(N)=N/N)c(C)c1C |
| InChI | InChI=1S/C28H33N3O3/c1-15-13-23(33-14-22-11-9-8-10-12-22)16(2)17(3)24(15)28(32)34-26-20(6)18(4)25(27(29)31-30)19(5)21(26)7/h8-13H,14,30H2,1-7H3,(H2,29,31) |
| InChIKey | XYMUTILGLMIEAV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|