C23H22O4 — CID 88854777
phenyl 3-methoxy-2,5-dimethyl-6-phenylmethoxybenzoate (PubChem CID 88854777) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is phenyl 3-methoxy-2,5-dimethyl-6-phenylmethoxybenzoate.
| Compound Name | phenyl 3-methoxy-2,5-dimethyl-6-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 88854777 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | phenyl 3-methoxy-2,5-dimethyl-6-phenylmethoxybenzoate |
| SMILES | COc1cc(C)c(OCc2ccccc2)c(C(=O)Oc2ccccc2)c1C |
| InChI | InChI=1S/C23H22O4/c1-16-14-20(25-3)17(2)21(23(24)27-19-12-8-5-9-13-19)22(16)26-15-18-10-6-4-7-11-18/h4-14H,15H2,1-3H3 |
| InChIKey | XJTUWMUBYREKSA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|