C22H16F2O4 — CID 126596819
phenyl 3,5-difluoro-4-formyl-2-methyl-6-phenylmethoxybenzoate (PubChem CID 126596819) has the molecular formula C22H16F2O4 and a molecular weight of 382.36 g/mol. Its IUPAC name is phenyl 3,5-difluoro-4-formyl-2-methyl-6-phenylmethoxybenzoate.
| Compound Name | phenyl 3,5-difluoro-4-formyl-2-methyl-6-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 126596819 |
| Molecular Formula | C22H16F2O4 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | phenyl 3,5-difluoro-4-formyl-2-methyl-6-phenylmethoxybenzoate |
| SMILES | Cc1c(F)c(C=O)c(F)c(OCc2ccccc2)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C22H16F2O4/c1-14-18(22(26)28-16-10-6-3-7-11-16)21(20(24)17(12-25)19(14)23)27-13-15-8-4-2-5-9-15/h2-12H,13H2,1H3 |
| InChIKey | PIOLBAOKZSWPBP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|