C28H30FNO3 — CID 58493287
phenyl 2-(2,2-dimethylpropyl)-7-fluoro-6-methyl-4-phenylmethoxy-1,3-dihydroisoindole-5-carboxylate (PubChem CID 58493287) has the molecular formula C28H30FNO3 and a molecular weight of 447.55 g/mol. Its IUPAC name is phenyl 2-(2,2-dimethylpropyl)-7-fluoro-6-methyl-4-phenylmethoxy-1,3-dihydroisoindole-5-carboxylate.
| Compound Name | phenyl 2-(2,2-dimethylpropyl)-7-fluoro-6-methyl-4-phenylmethoxy-1,3-dihydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 58493287 |
| Molecular Formula | C28H30FNO3 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | phenyl 2-(2,2-dimethylpropyl)-7-fluoro-6-methyl-4-phenylmethoxy-1,3-dihydroisoindole-5-carboxylate |
| SMILES | Cc1c(F)c2c(c(OCc3ccccc3)c1C(=O)Oc1ccccc1)CN(CC(C)(C)C)C2 |
| InChI | InChI=1S/C28H30FNO3/c1-19-24(27(31)33-21-13-9-6-10-14-21)26(32-17-20-11-7-5-8-12-20)23-16-30(18-28(2,3)4)15-22(23)25(19)29/h5-14H,15-18H2,1-4H3 |
| InChIKey | FHBYEPOMIDTFNN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|