C25H30FNO4 — CID 70667235
phenyl 4-butoxy-7-fluoro-6-methyl-2-[[(2R)-oxolan-2-yl]methyl]-1,3-dihydroisoindole-5-carboxylate (PubChem CID 70667235) has the molecular formula C25H30FNO4 and a molecular weight of 427.52 g/mol. Its IUPAC name is phenyl 4-butoxy-7-fluoro-6-methyl-2-[[(2R)-oxolan-2-yl]methyl]-1,3-dihydroisoindole-5-carboxylate.
| Compound Name | phenyl 4-butoxy-7-fluoro-6-methyl-2-[[(2R)-oxolan-2-yl]methyl]-1,3-dihydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 70667235 |
| Molecular Formula | C25H30FNO4 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | phenyl 4-butoxy-7-fluoro-6-methyl-2-[[(2R)-oxolan-2-yl]methyl]-1,3-dihydroisoindole-5-carboxylate |
| SMILES | CCCCOc1c2c(c(F)c(C)c1C(=O)Oc1ccccc1)CN(C[C@H]1CCCO1)C2 |
| InChI | InChI=1S/C25H30FNO4/c1-3-4-12-30-24-21-16-27(14-19-11-8-13-29-19)15-20(21)23(26)17(2)22(24)25(28)31-18-9-6-5-7-10-18/h5-7,9-10,19H,3-4,8,11-16H2,1-2H3/t19-/m1/s1 |
| InChIKey | VVPOEXPSKONTFF-LJQANCHMSA-N |
| XLogP | 5.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|