C23H26O6 — CID 17178841
oxolan-2-ylmethyl 3-(4-butoxybenzoyl)oxybenzoate (PubChem CID 17178841) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-(4-butoxybenzoyl)oxybenzoate.
| Compound Name | oxolan-2-ylmethyl 3-(4-butoxybenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 17178841 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | oxolan-2-ylmethyl 3-(4-butoxybenzoyl)oxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2cccc(C(=O)OCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C23H26O6/c1-2-3-13-26-19-11-9-17(10-12-19)23(25)29-20-7-4-6-18(15-20)22(24)28-16-21-8-5-14-27-21/h4,6-7,9-12,15,21H,2-3,5,8,13-14,16H2,1H3 |
| InChIKey | XXCSSNTVZABGBF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|