C22H24O6 — CID 17178822
oxolan-2-ylmethyl 3-[2-(2,5-dimethylphenoxy)acetyl]oxybenzoate (PubChem CID 17178822) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-[2-(2,5-dimethylphenoxy)acetyl]oxybenzoate.
| Compound Name | oxolan-2-ylmethyl 3-[2-(2,5-dimethylphenoxy)acetyl]oxybenzoate |
|---|---|
| PubChem CID | 17178822 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | oxolan-2-ylmethyl 3-[2-(2,5-dimethylphenoxy)acetyl]oxybenzoate |
| SMILES | Cc1ccc(C)c(OCC(=O)Oc2cccc(C(=O)OCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C22H24O6/c1-15-8-9-16(2)20(11-15)26-14-21(23)28-18-6-3-5-17(12-18)22(24)27-13-19-7-4-10-25-19/h3,5-6,8-9,11-12,19H,4,7,10,13-14H2,1-2H3 |
| InChIKey | QCJNVTYILCFHIX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|