C20H19BrO5 — CID 17178819
[3-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-bromo-4-methylbenzoate (PubChem CID 17178819) has the molecular formula C20H19BrO5 and a molecular weight of 419.27 g/mol. Its IUPAC name is [3-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-bromo-4-methylbenzoate.
| Compound Name | [3-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-bromo-4-methylbenzoate |
|---|---|
| PubChem CID | 17178819 |
| Molecular Formula | C20H19BrO5 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | [3-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-bromo-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cccc(C(=O)OCC3CCCO3)c2)cc1Br |
| InChI | InChI=1S/C20H19BrO5/c1-13-7-8-15(11-18(13)21)20(23)26-16-5-2-4-14(10-16)19(22)25-12-17-6-3-9-24-17/h2,4-5,7-8,10-11,17H,3,6,9,12H2,1H3 |
| InChIKey | NRZVPWWMWZWCHR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|