C19H17NO7 — CID 17201532
[4-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-nitrobenzoate (PubChem CID 17201532) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is [4-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-nitrobenzoate.
| Compound Name | [4-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 17201532 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | [4-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-nitrobenzoate |
| SMILES | O=C(OCC1CCCO1)c1ccc(OC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H17NO7/c21-18(26-12-17-5-2-10-25-17)13-6-8-16(9-7-13)27-19(22)14-3-1-4-15(11-14)20(23)24/h1,3-4,6-9,11,17H,2,5,10,12H2 |
| InChIKey | PUOAFQVXZODKRS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|