C24H27BrO6 — CID 17178879
oxolan-2-ylmethyl 3-[2-(4-bromo-2-tert-butylphenoxy)acetyl]oxybenzoate (PubChem CID 17178879) has the molecular formula C24H27BrO6 and a molecular weight of 491.38 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-[2-(4-bromo-2-tert-butylphenoxy)acetyl]oxybenzoate.
| Compound Name | oxolan-2-ylmethyl 3-[2-(4-bromo-2-tert-butylphenoxy)acetyl]oxybenzoate |
|---|---|
| PubChem CID | 17178879 |
| Molecular Formula | C24H27BrO6 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | oxolan-2-ylmethyl 3-[2-(4-bromo-2-tert-butylphenoxy)acetyl]oxybenzoate |
| SMILES | CC(C)(C)c1cc(Br)ccc1OCC(=O)Oc1cccc(C(=O)OCC2CCCO2)c1 |
| InChI | InChI=1S/C24H27BrO6/c1-24(2,3)20-13-17(25)9-10-21(20)29-15-22(26)31-18-7-4-6-16(12-18)23(27)30-14-19-8-5-11-28-19/h4,6-7,9-10,12-13,19H,5,8,11,14-15H2,1-3H3 |
| InChIKey | KPYPVCVIKDZCRV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|