C27H26O6 — CID 17178851
oxolan-2-ylmethyl 3-[2-(4-phenylphenoxy)propanoyloxy]benzoate (PubChem CID 17178851) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-[2-(4-phenylphenoxy)propanoyloxy]benzoate.
| Compound Name | oxolan-2-ylmethyl 3-[2-(4-phenylphenoxy)propanoyloxy]benzoate |
|---|---|
| PubChem CID | 17178851 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | oxolan-2-ylmethyl 3-[2-(4-phenylphenoxy)propanoyloxy]benzoate |
| SMILES | CC(Oc1ccc(-c2ccccc2)cc1)C(=O)Oc1cccc(C(=O)OCC2CCCO2)c1 |
| InChI | InChI=1S/C27H26O6/c1-19(32-23-14-12-21(13-15-23)20-7-3-2-4-8-20)26(28)33-24-10-5-9-22(17-24)27(29)31-18-25-11-6-16-30-25/h2-5,7-10,12-15,17,19,25H,6,11,16,18H2,1H3 |
| InChIKey | ODEZLRVVJWMGOI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|