C21H17ClO5S — CID 17178797
[3-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 17178797) has the molecular formula C21H17ClO5S and a molecular weight of 416.88 g/mol. Its IUPAC name is [3-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [3-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 17178797 |
| Molecular Formula | C21H17ClO5S |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [3-(oxolan-2-ylmethoxycarbonyl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(OCC1CCCO1)c1cccc(OC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C21H17ClO5S/c22-18-16-8-1-2-9-17(16)28-19(18)21(24)27-14-6-3-5-13(11-14)20(23)26-12-15-7-4-10-25-15/h1-3,5-6,8-9,11,15H,4,7,10,12H2 |
| InChIKey | BGODTNAOCLWTMS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|